(3,5-DIFLUOROPYRIDIN-4-YL)BORONIC ACID

(3,5-DIFLUOROPYRIDIN-4-YL)BORONIC ACID - Names and Identifiers

Name	(3,5-Difluoropyridine-4-yl)boronic acid
Synonyms	3,5-Difluoropyridine-4-boronic acid 3,5-DIFLUOROPYRIDINE-4-BORONIC ACID (3,5-DIFLUOROPYRIDIN-4-YL)BORONIC ACID (3,5-Difluoropyridin-4-yl)boronic acid (3,5-DIFLUOROPYRIDINE-4-YL)BORONIC ACID (3,5-Difluoropyridine-4-yl)boronic acid boronic acid, B-(3,5-difluoro-4-pyridinyl)- Boronic acid, B-(3,5-difluoro-4-pyridinyl)-
CAS	956003-87-5
InChI	InChI=1/C5H4BF2NO2/c7-3-1-9-2-4(8)5(3)6(10)11/h1-2,10-11H

(3,5-DIFLUOROPYRIDIN-4-YL)BORONIC ACID - Physico-chemical Properties

Molecular Formula	C5H4BF2NO2
Molar Mass	158.9
Density	1.44g/cm³
Boling Point	261.7°C at 760 mmHg
Flash Point	112°C
Vapor Presure	0.00577mmHg at 25°C
Storage Condition	Inert atmosphere,Store in freezer, under -20°C
Refractive Index	1.482

(3,5-DIFLUOROPYRIDIN-4-YL)BORONIC ACID - Introduction

(3,5-Difluoropyridine-4-yl)boronic acid is an organic compound with the chemical formula C5H4BF2N.

Its properties are as follows:
1. Appearance: white solid
2. melting point: about 165-170 degrees Celsius
3. Solubility: Soluble in common organic solvents such as ethanol, dimethyl sulfoxide and acetonitrile

(3,5-Difluoropyridine-4-yl)boronic acid is mainly used as follows:
1. In organic synthesis reactions, they are often used as intermediates or reagents for organic synthesis.
2. can be used as a ligand for organometallic catalytic reaction.

The method for preparing (3,5-Difluoropyridine-4-yl)boronic acid generally includes the following steps:
1. React 3,5-difluoropyridine with boron trichloride to generate (3,5-Difluoropyridine-4-yl)boronic acid trichloride intermediate.
2. The intermediate is reacted with an alcohol or ether solvent to generate (3,5-Difluoropyridine-4-yl)boronic acid.

Pay attention to the following safety information when using or storing (3,5-Difluoropyridine-4-yl)boronic acid:
1. contact with skin, eyes and respiratory tract should be avoided to prevent irritation and injury.
2. in the process of operation should wear protective gloves, protective glasses and protective masks.
3. It should be used in a well-ventilated place and avoid dust.
4. storage should keep sealed, avoid with oxygen, moisture and acid-base reaction.
5. such as accidental inhalation or ingestion, should immediately seek medical treatment.

Last Update：2024-04-10 22:29:15